C9H10Cl2FNO3S — CID 103088486
2,4-dichloro-3-fluoro-N-(3-hydroxypropyl)benzenesulfonamide (PubChem CID 103088486) has the molecular formula C9H10Cl2FNO3S and a molecular weight of 302.15 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-(3-hydroxypropyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-(3-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088486 |
| Molecular Formula | C9H10Cl2FNO3S |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-(3-hydroxypropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCO)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C9H10Cl2FNO3S/c10-6-2-3-7(8(11)9(6)12)17(15,16)13-4-1-5-14/h2-3,13-14H,1,4-5H2 |
| InChIKey | XKQZTRMZOMIOPZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|