C10H14Cl3FN2O2S — CID 120713472
N-(4-aminobutyl)-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120713472) has the molecular formula C10H14Cl3FN2O2S and a molecular weight of 351.66 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120713472 |
| Molecular Formula | C10H14Cl3FN2O2S |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | N-(4-aminobutyl)-2,4-dichloro-3-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCCNS(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H13Cl2FN2O2S.ClH/c11-7-3-4-8(9(12)10(7)13)18(16,17)15-6-2-1-5-14;/h3-4,15H,1-2,5-6,14H2;1H |
| InChIKey | RDLCQPMMJRKDSO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|