C10H15Cl3N2O2S — CID 120583800
N-(4-aminobutyl)-2,6-dichlorobenzenesulfonamide;hydrochloride (PubChem CID 120583800) has the molecular formula C10H15Cl3N2O2S and a molecular weight of 333.67 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,6-dichlorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-2,6-dichlorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583800 |
| Molecular Formula | C10H15Cl3N2O2S |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | N-(4-aminobutyl)-2,6-dichlorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S.ClH/c11-8-4-3-5-9(12)10(8)17(15,16)14-7-2-1-6-13;/h3-5,14H,1-2,6-7,13H2;1H |
| InChIKey | WRWDOPYNBOKHPD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|