3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid

C9H9Cl2NO4S — CID 697936

IUPAC3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid
SMILESO=C(O)CCNS(=O)(=O)c1c(Cl)cccc1Cl
InChIInChI=1S/C9H9Cl2NO4S/c10-6-2-1-3-7(11)9(6)17(15,16)12-5-4-8(13)14/h1-3,12H,4-5H2,(H,13,14)
InChIKeyALZFPJUXLAZZRV-UHFFFAOYSA-N
MW298.15 g/mol
LogP1.75
Rot. Bonds5

About 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid

3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 697936) has the molecular formula C9H9Cl2NO4S and a molecular weight of 298.15 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid
PubChem CID697936
Molecular FormulaC9H9Cl2NO4S
Molecular Weight298.15 g/mol
Exact Mass296.96
IUPAC Name3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid
SMILESO=C(O)CCNS(=O)(=O)c1c(Cl)cccc1Cl
InChIInChI=1S/C9H9Cl2NO4S/c10-6-2-1-3-7(11)9(6)17(15,16)12-5-4-8(13)14/h1-3,12H,4-5H2,(H,13,14)
InChIKeyALZFPJUXLAZZRV-UHFFFAOYSA-N
XLogP1.75
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.15
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The IUPAC name of 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid (CID 697936) is 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The canonical SMILES for 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid is O=C(O)CCNS(=O)(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The InChIKey is ALZFPJUXLAZZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO4S/c10-6-2-1-3-7(11)9(6)17(15,16)12-5-4-8(13)14/h1-3,12H,4-5H2,(H,13,14).
What are the key properties of 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid has a molecular weight of 298.15 g/mol, XLogP of 1.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid is sourced from PubChem (CID 697936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).