C9H9Cl2NO4S — CID 697936
3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 697936) has the molecular formula C9H9Cl2NO4S and a molecular weight of 298.15 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 697936 |
| Molecular Formula | C9H9Cl2NO4S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2NO4S/c10-6-2-1-3-7(11)9(6)17(15,16)12-5-4-8(13)14/h1-3,12H,4-5H2,(H,13,14) |
| InChIKey | ALZFPJUXLAZZRV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |