C13H16Cl2N2O5S — CID 119352507
4-[3-[(2,6-dichlorophenyl)sulfonylamino]propanoylamino]butanoic acid (PubChem CID 119352507) has the molecular formula C13H16Cl2N2O5S and a molecular weight of 383.25 g/mol. Its IUPAC name is 4-[3-[(2,6-dichlorophenyl)sulfonylamino]propanoylamino]butanoic acid.
| Compound Name | 4-[3-[(2,6-dichlorophenyl)sulfonylamino]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119352507 |
| Molecular Formula | C13H16Cl2N2O5S |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 4-[3-[(2,6-dichlorophenyl)sulfonylamino]propanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O5S/c14-9-3-1-4-10(15)13(9)23(21,22)17-8-6-11(18)16-7-2-5-12(19)20/h1,3-4,17H,2,5-8H2,(H,16,18)(H,19,20) |
| InChIKey | FVOKSPLOMLVJGF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|