C13H19Cl2N3O3S — CID 119498614
N-(3-aminobutyl)-3-[(2,6-dichlorophenyl)sulfonylamino]propanamide (PubChem CID 119498614) has the molecular formula C13H19Cl2N3O3S and a molecular weight of 368.29 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-[(2,6-dichlorophenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-aminobutyl)-3-[(2,6-dichlorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 119498614 |
| Molecular Formula | C13H19Cl2N3O3S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-(3-aminobutyl)-3-[(2,6-dichlorophenyl)sulfonylamino]propanamide |
| SMILES | CC(N)CCNC(=O)CCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H19Cl2N3O3S/c1-9(16)5-7-17-12(19)6-8-18-22(20,21)13-10(14)3-2-4-11(13)15/h2-4,9,18H,5-8,16H2,1H3,(H,17,19) |
| InChIKey | GIKBGYBRKCBAEV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |