C14H14Cl2N2O4S — CID 51120099
3-[(2,6-dichlorophenyl)sulfonylamino]-N-(furan-3-ylmethyl)propanamide (PubChem CID 51120099) has the molecular formula C14H14Cl2N2O4S and a molecular weight of 377.25 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)sulfonylamino]-N-(furan-3-ylmethyl)propanamide.
| Compound Name | 3-[(2,6-dichlorophenyl)sulfonylamino]-N-(furan-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 51120099 |
| Molecular Formula | C14H14Cl2N2O4S |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)sulfonylamino]-N-(furan-3-ylmethyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1c(Cl)cccc1Cl)NCc1ccoc1 |
| InChI | InChI=1S/C14H14Cl2N2O4S/c15-11-2-1-3-12(16)14(11)23(20,21)18-6-4-13(19)17-8-10-5-7-22-9-10/h1-3,5,7,9,18H,4,6,8H2,(H,17,19) |
| InChIKey | MKIHJVJSWAKZCG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |