C18H18ClN5O3S — CID 55635678
3-[(2-chlorophenyl)sulfonylamino]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]propanamide (PubChem CID 55635678) has the molecular formula C18H18ClN5O3S and a molecular weight of 419.89 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 55635678 |
| Molecular Formula | C18H18ClN5O3S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)NCc1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H18ClN5O3S/c19-15-4-1-2-5-16(15)28(26,27)23-10-7-18(25)21-13-14-6-9-20-17(12-14)24-11-3-8-22-24/h1-6,8-9,11-12,23H,7,10,13H2,(H,21,25) |
| InChIKey | VNROMPVLXCYWLV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |