C19H23ClN2O5S — CID 55858772
3-[(2-chlorophenyl)sulfonylamino]-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide (PubChem CID 55858772) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55858772 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide |
| SMILES | COCCOc1cccc(CNC(=O)CCNS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O5S/c1-26-11-12-27-16-6-4-5-15(13-16)14-21-19(23)9-10-22-28(24,25)18-8-3-2-7-17(18)20/h2-8,13,22H,9-12,14H2,1H3,(H,21,23) |
| InChIKey | FMFMEDCDBXRGRE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|