C17H18ClNO4S — CID 25162879
3-(2-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]propanamide (PubChem CID 25162879) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 25162879 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 3-(2-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]propanamide |
| SMILES | COc1cccc(CNC(=O)CCS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-23-14-6-4-5-13(11-14)12-19-17(20)9-10-24(21,22)16-8-3-2-7-15(16)18/h2-8,11H,9-10,12H2,1H3,(H,19,20) |
| InChIKey | FAHXYLPPLHXZFL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |