C18H20FNO4S — CID 5177299
3-[(2-fluorophenyl)methylsulfonyl]-N-[(3-methoxyphenyl)methyl]propanamide (PubChem CID 5177299) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methylsulfonyl]-N-[(3-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-[(3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 5177299 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-[(3-methoxyphenyl)methyl]propanamide |
| SMILES | COc1cccc(CNC(=O)CCS(=O)(=O)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C18H20FNO4S/c1-24-16-7-4-5-14(11-16)12-20-18(21)9-10-25(22,23)13-15-6-2-3-8-17(15)19/h2-8,11H,9-10,12-13H2,1H3,(H,20,21) |
| InChIKey | PKKXWOWRZIPTTJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |