C19H22FNO2 — CID 95172563
3-(2-fluorophenyl)-N-[3-(3-methoxyphenyl)propyl]propanamide (PubChem CID 95172563) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[3-(3-methoxyphenyl)propyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[3-(3-methoxyphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 95172563 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[3-(3-methoxyphenyl)propyl]propanamide |
| SMILES | COc1cccc(CCCNC(=O)CCc2ccccc2F)c1 |
| InChI | InChI=1S/C19H22FNO2/c1-23-17-9-4-6-15(14-17)7-5-13-21-19(22)12-11-16-8-2-3-10-18(16)20/h2-4,6,8-10,14H,5,7,11-13H2,1H3,(H,21,22) |
| InChIKey | SRSWTYYOXFGMJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|