C21H25FN2O3 — CID 113055919
N-[2-[acetyl-[2-(3-methoxyphenyl)ethyl]amino]ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 113055919) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[2-[acetyl-[2-(3-methoxyphenyl)ethyl]amino]ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-[acetyl-[2-(3-methoxyphenyl)ethyl]amino]ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113055919 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[2-[acetyl-[2-(3-methoxyphenyl)ethyl]amino]ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | COc1cccc(CCN(CCNC(=O)Cc2ccccc2F)C(C)=O)c1 |
| InChI | InChI=1S/C21H25FN2O3/c1-16(25)24(12-10-17-6-5-8-19(14-17)27-2)13-11-23-21(26)15-18-7-3-4-9-20(18)22/h3-9,14H,10-13,15H2,1-2H3,(H,23,26) |
| InChIKey | JSIRWELBMOIGKF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |