C21H24FNO3 — CID 110607212
N-[4-(2-fluorophenyl)butyl]-4-(3-methoxyphenyl)-4-oxobutanamide (PubChem CID 110607212) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[4-(2-fluorophenyl)butyl]-4-(3-methoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[4-(2-fluorophenyl)butyl]-4-(3-methoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110607212 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[4-(2-fluorophenyl)butyl]-4-(3-methoxyphenyl)-4-oxobutanamide |
| SMILES | COc1cccc(C(=O)CCC(=O)NCCCCc2ccccc2F)c1 |
| InChI | InChI=1S/C21H24FNO3/c1-26-18-10-6-9-17(15-18)20(24)12-13-21(25)23-14-5-4-8-16-7-2-3-11-19(16)22/h2-3,6-7,9-11,15H,4-5,8,12-14H2,1H3,(H,23,25) |
| InChIKey | WAUGWSNFPYVLGP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|