C19H20N2O4 — CID 110624279
N-(2-anilino-2-oxoethyl)-4-(3-methoxyphenyl)-4-oxobutanamide (PubChem CID 110624279) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-4-(3-methoxyphenyl)-4-oxobutanamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-4-(3-methoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110624279 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-4-(3-methoxyphenyl)-4-oxobutanamide |
| SMILES | COc1cccc(C(=O)CCC(=O)NCC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-25-16-9-5-6-14(12-16)17(22)10-11-18(23)20-13-19(24)21-15-7-3-2-4-8-15/h2-9,12H,10-11,13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HULROILGODWQOH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |