C15H19F3N2O3 — CID 108934905
3-(3-methoxyphenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide (PubChem CID 108934905) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide.
| Compound Name | 3-(3-methoxyphenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 108934905 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide |
| SMILES | COc1cccc(CCC(=O)NCCCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-23-12-5-2-4-11(10-12)6-7-13(21)19-8-3-9-20-14(22)15(16,17)18/h2,4-5,10H,3,6-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | LJKDGPSRLVBFHD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|