C18H22N2O2 — CID 119549328
N-[2-(4-aminophenyl)ethyl]-3-(3-methoxyphenyl)propanamide (PubChem CID 119549328) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-(3-methoxyphenyl)propanamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 119549328 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-(3-methoxyphenyl)propanamide |
| SMILES | COc1cccc(CCC(=O)NCCc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-22-17-4-2-3-15(13-17)7-10-18(21)20-12-11-14-5-8-16(19)9-6-14/h2-6,8-9,13H,7,10-12,19H2,1H3,(H,20,21) |
| InChIKey | XVIRPNHESXDXJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|