C15H23N3O3 — CID 166390750
4-(2,2-dimethylhydrazinyl)-N-[2-(3-methoxyphenyl)ethyl]-4-oxobutanamide (PubChem CID 166390750) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-N-[2-(3-methoxyphenyl)ethyl]-4-oxobutanamide.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-N-[2-(3-methoxyphenyl)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 166390750 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-N-[2-(3-methoxyphenyl)ethyl]-4-oxobutanamide |
| SMILES | COc1cccc(CCNC(=O)CCC(=O)NN(C)C)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-18(2)17-15(20)8-7-14(19)16-10-9-12-5-4-6-13(11-12)21-3/h4-6,11H,7-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | ZTGYMRCOSDFVRI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|