C21H25NO6 — CID 22685572
4-[2-[3-[2-(3-methoxyphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid (PubChem CID 22685572) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-[2-[3-[2-(3-methoxyphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[3-[2-(3-methoxyphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22685572 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[2-[3-[2-(3-methoxyphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
| SMILES | COc1cccc(OCCOc2cccc(CCNC(=O)CCC(=O)O)c2)c1 |
| InChI | InChI=1S/C21H25NO6/c1-26-17-5-3-7-19(15-17)28-13-12-27-18-6-2-4-16(14-18)10-11-22-20(23)8-9-21(24)25/h2-7,14-15H,8-13H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | NKAINAPFVDMJIJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|