C20H22FNO5 — CID 22683551
4-[2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid (PubChem CID 22683551) has the molecular formula C20H22FNO5 and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22683551 |
| Molecular Formula | C20H22FNO5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-[2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1cccc(OCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H22FNO5/c21-16-4-6-17(7-5-16)26-12-13-27-18-3-1-2-15(14-18)10-11-22-19(23)8-9-20(24)25/h1-7,14H,8-13H2,(H,22,23)(H,24,25) |
| InChIKey | PAEAWWRVOWWQDQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|