C13H18ClNO4 — CID 170649983
4-[2-(3-methoxyphenyl)ethylamino]-4-oxobutanoic acid;hydrochloride (PubChem CID 170649983) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenyl)ethylamino]-4-oxobutanoic acid;hydrochloride.
| Compound Name | 4-[2-(3-methoxyphenyl)ethylamino]-4-oxobutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170649983 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-[2-(3-methoxyphenyl)ethylamino]-4-oxobutanoic acid;hydrochloride |
| SMILES | COc1cccc(CCNC(=O)CCC(=O)O)c1.Cl |
| InChI | InChI=1S/C13H17NO4.ClH/c1-18-11-4-2-3-10(9-11)7-8-14-12(15)5-6-13(16)17;/h2-4,9H,5-8H2,1H3,(H,14,15)(H,16,17);1H |
| InChIKey | OKIULBWYBDINNR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |