C16H23NO4 — CID 106703116
5-[2-(3-methoxyphenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 106703116) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[2-(3-methoxyphenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106703116 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 5-[2-(3-methoxyphenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | COc1cccc(CCNC(=O)CC(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C16H23NO4/c1-16(2,11-15(19)20)10-14(18)17-8-7-12-5-4-6-13(9-12)21-3/h4-6,9H,7-8,10-11H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | DNTBHNCITULUGY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |