C17H26N2O4 — CID 86673951
tert-butyl N-[3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropyl]carbamate (PubChem CID 86673951) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 86673951 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropyl]carbamate |
| SMILES | COc1cccc(CCNC(=O)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)19-11-9-15(20)18-10-8-13-6-5-7-14(12-13)22-4/h5-7,12H,8-11H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | KAFOFEMAPYDVMO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |