C12H16F3NO2 — CID 143097704
ethane;2,2,2-trifluoro-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 143097704) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | ethane;2,2,2-trifluoro-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 143097704 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | ethane;2,2,2-trifluoro-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | CC.COc1cccc(CNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3NO2.C2H6/c1-16-8-4-2-3-7(5-8)6-14-9(15)10(11,12)13;1-2/h2-5H,6H2,1H3,(H,14,15);1-2H3 |
| InChIKey | GHYSDUMIXFSTRU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |