C10H12N2O3 — CID 69052749
N'-[(3-methoxyphenyl)methyl]oxamide (PubChem CID 69052749) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N'-[(3-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(3-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 69052749 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N'-[(3-methoxyphenyl)methyl]oxamide |
| SMILES | COc1cccc(CNC(=O)C(N)=O)c1 |
| InChI | InChI=1S/C10H12N2O3/c1-15-8-4-2-3-7(5-8)6-12-10(14)9(11)13/h2-5H,6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | KXRQKEVWUVUBRS-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|