C13H15F3N2O3 — CID 21259011
3-amino-5,5,5-trifluoro-N-[(3-methoxyphenyl)methyl]-2-oxopentanamide (PubChem CID 21259011) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 3-amino-5,5,5-trifluoro-N-[(3-methoxyphenyl)methyl]-2-oxopentanamide.
| Compound Name | 3-amino-5,5,5-trifluoro-N-[(3-methoxyphenyl)methyl]-2-oxopentanamide |
|---|---|
| PubChem CID | 21259011 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-amino-5,5,5-trifluoro-N-[(3-methoxyphenyl)methyl]-2-oxopentanamide |
| SMILES | COc1cccc(CNC(=O)C(=O)C(N)CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-21-9-4-2-3-8(5-9)7-18-12(20)11(19)10(17)6-13(14,15)16/h2-5,10H,6-7,17H2,1H3,(H,18,20) |
| InChIKey | ULEHCKBLLBLAHI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|