C12H18ClN3O3 — CID 119955853
2-amino-N-[(3-methoxyphenyl)methyl]butanediamide;hydrochloride (PubChem CID 119955853) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-amino-N-[(3-methoxyphenyl)methyl]butanediamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-methoxyphenyl)methyl]butanediamide;hydrochloride |
|---|---|
| PubChem CID | 119955853 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-amino-N-[(3-methoxyphenyl)methyl]butanediamide;hydrochloride |
| SMILES | COc1cccc(CNC(=O)C(N)CC(N)=O)c1.Cl |
| InChI | InChI=1S/C12H17N3O3.ClH/c1-18-9-4-2-3-8(5-9)7-15-12(17)10(13)6-11(14)16;/h2-5,10H,6-7,13H2,1H3,(H2,14,16)(H,15,17);1H |
| InChIKey | CXTJMJHXCBCFDR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |