C12H15Br2NO2 — CID 67625242
(2S)-2,4-dibromo-N-[(3-methoxyphenyl)methyl]butanamide (PubChem CID 67625242) has the molecular formula C12H15Br2NO2 and a molecular weight of 365.07 g/mol. Its IUPAC name is (2S)-2,4-dibromo-N-[(3-methoxyphenyl)methyl]butanamide.
| Compound Name | (2S)-2,4-dibromo-N-[(3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 67625242 |
| Molecular Formula | C12H15Br2NO2 |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | (2S)-2,4-dibromo-N-[(3-methoxyphenyl)methyl]butanamide |
| SMILES | COc1cccc(CNC(=O)[C@@H](Br)CCBr)c1 |
| InChI | InChI=1S/C12H15Br2NO2/c1-17-10-4-2-3-9(7-10)8-15-12(16)11(14)5-6-13/h2-4,7,11H,5-6,8H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | HWZSUCJWAANBCC-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|