C14H20N2O3 — CID 44902382
N-[(3-methoxyphenyl)methyl]-N'-(2-methylpropyl)oxamide (PubChem CID 44902382) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 44902382 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-N'-(2-methylpropyl)oxamide |
| SMILES | COc1cccc(CNC(=O)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-10(2)8-15-13(17)14(18)16-9-11-5-4-6-12(7-11)19-3/h4-7,10H,8-9H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | YTJDWXNCYVWUOZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|