C18H23F3N2O5 — CID 21258992
tert-butyl N-[1,1,1-trifluoro-5-[(3-methoxyphenyl)methylamino]-4,5-dioxopentan-3-yl]carbamate (PubChem CID 21258992) has the molecular formula C18H23F3N2O5 and a molecular weight of 404.39 g/mol. Its IUPAC name is tert-butyl N-[1,1,1-trifluoro-5-[(3-methoxyphenyl)methylamino]-4,5-dioxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1,1,1-trifluoro-5-[(3-methoxyphenyl)methylamino]-4,5-dioxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 21258992 |
| Molecular Formula | C18H23F3N2O5 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | tert-butyl N-[1,1,1-trifluoro-5-[(3-methoxyphenyl)methylamino]-4,5-dioxopentan-3-yl]carbamate |
| SMILES | COc1cccc(CNC(=O)C(=O)C(CC(F)(F)F)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H23F3N2O5/c1-17(2,3)28-16(26)23-13(9-18(19,20)21)14(24)15(25)22-10-11-6-5-7-12(8-11)27-4/h5-8,13H,9-10H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | KZWRDGQQQLNUNA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|