C15H24N2O3 — CID 84730445
tert-butyl N-[1-amino-3-(3-methoxyphenyl)propan-2-yl]carbamate (PubChem CID 84730445) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[1-amino-3-(3-methoxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-3-(3-methoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 84730445 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | tert-butyl N-[1-amino-3-(3-methoxyphenyl)propan-2-yl]carbamate |
| SMILES | COc1cccc(CC(CN)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-15(2,3)20-14(18)17-12(10-16)8-11-6-5-7-13(9-11)19-4/h5-7,9,12H,8,10,16H2,1-4H3,(H,17,18) |
| InChIKey | LYEUVGOETYWRHI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |