C16H18ClNO3S — CID 46644070
2-chloro-N-[3-(3-methylphenoxy)propyl]benzenesulfonamide (PubChem CID 46644070) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is 2-chloro-N-[3-(3-methylphenoxy)propyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(3-methylphenoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46644070 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-chloro-N-[3-(3-methylphenoxy)propyl]benzenesulfonamide |
| SMILES | Cc1cccc(OCCCNS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H18ClNO3S/c1-13-6-4-7-14(12-13)21-11-5-10-18-22(19,20)16-9-3-2-8-15(16)17/h2-4,6-9,12,18H,5,10-11H2,1H3 |
| InChIKey | PAPUWBJPIFPRCY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|