C18H21NO5S — CID 31769281
methyl 3-[3-(3-methylphenoxy)propylsulfamoyl]benzoate (PubChem CID 31769281) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 3-[3-(3-methylphenoxy)propylsulfamoyl]benzoate.
| Compound Name | methyl 3-[3-(3-methylphenoxy)propylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 31769281 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 3-[3-(3-methylphenoxy)propylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCCCOc2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H21NO5S/c1-14-6-3-8-16(12-14)24-11-5-10-19-25(21,22)17-9-4-7-15(13-17)18(20)23-2/h3-4,6-9,12-13,19H,5,10-11H2,1-2H3 |
| InChIKey | OZGVPDLLKNGFQT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|