C20H25NO5S — CID 100759392
methyl 3-[3-(3-propan-2-yloxyphenyl)propylsulfamoyl]benzoate (PubChem CID 100759392) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 3-[3-(3-propan-2-yloxyphenyl)propylsulfamoyl]benzoate.
| Compound Name | methyl 3-[3-(3-propan-2-yloxyphenyl)propylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 100759392 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | methyl 3-[3-(3-propan-2-yloxyphenyl)propylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCCCc2cccc(OC(C)C)c2)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-15(2)26-18-10-4-7-16(13-18)8-6-12-21-27(23,24)19-11-5-9-17(14-19)20(22)25-3/h4-5,7,9-11,13-15,21H,6,8,12H2,1-3H3 |
| InChIKey | YPNKQJIRSBGXDU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|