C18H18ClF3N2O4S — CID 55855014
3-[(2-chlorophenyl)sulfonylamino]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide (PubChem CID 55855014) has the molecular formula C18H18ClF3N2O4S and a molecular weight of 450.87 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 55855014 |
| Molecular Formula | C18H18ClF3N2O4S |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18ClF3N2O4S/c19-15-6-1-2-7-16(15)29(26,27)24-9-8-17(25)23-10-11-28-14-5-3-4-13(12-14)18(20,21)22/h1-7,12,24H,8-11H2,(H,23,25) |
| InChIKey | JNTWVGIUUGXOHV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|