C13H17F3N2O3 — CID 110894379
1-(3-hydroxypropyl)-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea (PubChem CID 110894379) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea |
|---|---|
| PubChem CID | 110894379 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea |
| SMILES | O=C(NCCCO)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3/c14-13(15,16)10-3-1-4-11(9-10)21-8-6-18-12(20)17-5-2-7-19/h1,3-4,9,19H,2,5-8H2,(H2,17,18,20) |
| InChIKey | OYXDAHSOEUGWAJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|