C15H21F3N2O2 — CID 119736716
(2S)-2-amino-3,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide (PubChem CID 119736716) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 119736716 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3N2O2/c1-14(2,3)12(19)13(21)20-7-8-22-11-6-4-5-10(9-11)15(16,17)18/h4-6,9,12H,7-8,19H2,1-3H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | TYDGAYCEEMKQCU-GFCCVEGCSA-N |
| XLogP | 2.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|