C18H17BrF3NO4 — CID 55803408
4-bromo-3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide (PubChem CID 55803408) has the molecular formula C18H17BrF3NO4 and a molecular weight of 448.24 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 55803408 |
| Molecular Formula | C18H17BrF3NO4 |
| Molecular Weight | 448.24 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCOc2cccc(C(F)(F)F)c2)cc(OC)c1Br |
| InChI | InChI=1S/C18H17BrF3NO4/c1-25-14-8-11(9-15(26-2)16(14)19)17(24)23-6-7-27-13-5-3-4-12(10-13)18(20,21)22/h3-5,8-10H,6-7H2,1-2H3,(H,23,24) |
| InChIKey | FQOFNOLSSBIDEM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|