C19H21BrN2O6 — CID 55919848
4-(2-amino-2-oxoethoxy)-N-[2-(3-bromophenoxy)ethyl]-3,5-dimethoxybenzamide (PubChem CID 55919848) has the molecular formula C19H21BrN2O6 and a molecular weight of 453.29 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[2-(3-bromophenoxy)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[2-(3-bromophenoxy)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 55919848 |
| Molecular Formula | C19H21BrN2O6 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[2-(3-bromophenoxy)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOc2cccc(Br)c2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C19H21BrN2O6/c1-25-15-8-12(9-16(26-2)18(15)28-11-17(21)23)19(24)22-6-7-27-14-5-3-4-13(20)10-14/h3-5,8-10H,6-7,11H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | WQWWLOIZXMACSI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|