C20H23ClN2O5 — CID 55724832
4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-5-methoxybenzamide (PubChem CID 55724832) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-5-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 55724832 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOc2c(C)cccc2C)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C20H23ClN2O5/c1-12-5-4-6-13(2)18(12)27-8-7-23-20(25)14-9-15(21)19(16(10-14)26-3)28-11-17(22)24/h4-6,9-10H,7-8,11H2,1-3H3,(H2,22,24)(H,23,25) |
| InChIKey | ZHLIOFNJJYLMTR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|