C14H21Cl2N3O4 — CID 119508033
4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(ethylamino)ethyl]-5-methoxybenzamide;hydrochloride (PubChem CID 119508033) has the molecular formula C14H21Cl2N3O4 and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(ethylamino)ethyl]-5-methoxybenzamide;hydrochloride.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(ethylamino)ethyl]-5-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119508033 |
| Molecular Formula | C14H21Cl2N3O4 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-[2-(ethylamino)ethyl]-5-methoxybenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cc(Cl)c(OCC(N)=O)c(OC)c1.Cl |
| InChI | InChI=1S/C14H20ClN3O4.ClH/c1-3-17-4-5-18-14(20)9-6-10(15)13(11(7-9)21-2)22-8-12(16)19;/h6-7,17H,3-5,8H2,1-2H3,(H2,16,19)(H,18,20);1H |
| InChIKey | YXMRNJMYDPESOH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|