C14H22ClN3O4 — CID 119505376
4-(2-amino-2-oxoethoxy)-N-[2-(ethylamino)ethyl]-3-methoxybenzamide;hydrochloride (PubChem CID 119505376) has the molecular formula C14H22ClN3O4 and a molecular weight of 331.80 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[2-(ethylamino)ethyl]-3-methoxybenzamide;hydrochloride.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[2-(ethylamino)ethyl]-3-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119505376 |
| Molecular Formula | C14H22ClN3O4 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[2-(ethylamino)ethyl]-3-methoxybenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(OCC(N)=O)c(OC)c1.Cl |
| InChI | InChI=1S/C14H21N3O4.ClH/c1-3-16-6-7-17-14(19)10-4-5-11(12(8-10)20-2)21-9-13(15)18;/h4-5,8,16H,3,6-7,9H2,1-2H3,(H2,15,18)(H,17,19);1H |
| InChIKey | MSVMAGKSOCAWDG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|