C19H29N3O4 — CID 119619542
4-(2-amino-2-oxoethoxy)-N-[2-(cycloheptylamino)ethyl]-3-methoxybenzamide (PubChem CID 119619542) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[2-(cycloheptylamino)ethyl]-3-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[2-(cycloheptylamino)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 119619542 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[2-(cycloheptylamino)ethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCNC2CCCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H29N3O4/c1-25-17-12-14(8-9-16(17)26-13-18(20)23)19(24)22-11-10-21-15-6-4-2-3-5-7-15/h8-9,12,15,21H,2-7,10-11,13H2,1H3,(H2,20,23)(H,22,24) |
| InChIKey | LJMSENRJJNONFZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|