C23H30N2O3 — CID 5214532
3,4-dimethoxy-N-[2-[(4-phenylcyclohexyl)amino]ethyl]benzamide (PubChem CID 5214532) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[(4-phenylcyclohexyl)amino]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[(4-phenylcyclohexyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 5214532 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[(4-phenylcyclohexyl)amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC2CCC(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C23H30N2O3/c1-27-21-13-10-19(16-22(21)28-2)23(26)25-15-14-24-20-11-8-18(9-12-20)17-6-4-3-5-7-17/h3-7,10,13,16,18,20,24H,8-9,11-12,14-15H2,1-2H3,(H,25,26) |
| InChIKey | UQBIMLNRLZTYDP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|