C17H26ClN3O4 — CID 119620212
N-[2-(cycloheptylamino)ethyl]-3-methoxy-4-nitrobenzamide;hydrochloride (PubChem CID 119620212) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-methoxy-4-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-methoxy-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119620212 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-methoxy-4-nitrobenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NCCNC2CCCCCC2)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C17H25N3O4.ClH/c1-24-16-12-13(8-9-15(16)20(22)23)17(21)19-11-10-18-14-6-4-2-3-5-7-14;/h8-9,12,14,18H,2-7,10-11H2,1H3,(H,19,21);1H |
| InChIKey | GZXSNTXIJFFRBC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|