C16H25ClN4O3 — CID 119621228
4-amino-N-[2-(cycloheptylamino)ethyl]-3-nitrobenzamide;hydrochloride (PubChem CID 119621228) has the molecular formula C16H25ClN4O3 and a molecular weight of 356.85 g/mol. Its IUPAC name is 4-amino-N-[2-(cycloheptylamino)ethyl]-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(cycloheptylamino)ethyl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119621228 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-amino-N-[2-(cycloheptylamino)ethyl]-3-nitrobenzamide;hydrochloride |
| SMILES | Cl.Nc1ccc(C(=O)NCCNC2CCCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O3.ClH/c17-14-8-7-12(11-15(14)20(22)23)16(21)19-10-9-18-13-5-3-1-2-4-6-13;/h7-8,11,13,18H,1-6,9-10,17H2,(H,19,21);1H |
| InChIKey | MPAIPIJNUFFARY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|