C10H12N2O4 — CID 47120011
4-(2-amino-2-oxoethoxy)-3-methoxybenzamide (PubChem CID 47120011) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 47120011 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1OCC(N)=O |
| InChI | InChI=1S/C10H12N2O4/c1-15-8-4-6(10(12)14)2-3-7(8)16-5-9(11)13/h2-4H,5H2,1H3,(H2,11,13)(H2,12,14) |
| InChIKey | XRFMYBLATLPGIF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |