C16H23N3O3S — CID 2987165
2-[4-(4-ethylpiperazine-1-carbothioyl)-2-methoxyphenoxy]acetamide (PubChem CID 2987165) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazine-1-carbothioyl)-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-(4-ethylpiperazine-1-carbothioyl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 2987165 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[4-(4-ethylpiperazine-1-carbothioyl)-2-methoxyphenoxy]acetamide |
| SMILES | CCN1CCN(C(=S)c2ccc(OCC(N)=O)c(OC)c2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-18-6-8-19(9-7-18)16(23)12-4-5-13(14(10-12)21-2)22-11-15(17)20/h4-5,10H,3,6-9,11H2,1-2H3,(H2,17,20) |
| InChIKey | OWDRSZCUJQLMKJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|