C18H19ClN4O6 — CID 16961898
4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 16961898) has the molecular formula C18H19ClN4O6 and a molecular weight of 422.83 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 16961898 |
| Molecular Formula | C18H19ClN4O6 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCNc2ccccc2[N+](=O)[O-])cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H19ClN4O6/c1-28-15-9-11(8-12(19)17(15)29-10-16(20)24)18(25)22-7-6-21-13-4-2-3-5-14(13)23(26)27/h2-5,8-9,21H,6-7,10H2,1H3,(H2,20,24)(H,22,25) |
| InChIKey | FKCVGCDTQKACFF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|