C17H19N3O5 — CID 9278136
3,4-dimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 9278136) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9278136 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H19N3O5/c1-24-15-8-7-12(11-16(15)25-2)17(21)19-10-9-18-13-5-3-4-6-14(13)20(22)23/h3-8,11,18H,9-10H2,1-2H3,(H,19,21) |
| InChIKey | CLDHARQQEOFMJW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|